C26H26BrF3N5O4+ — CID 91209976
N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-4-ethylmorpholin-4-ium-4-carboxamide (PubChem CID 91209976) has the molecular formula C26H26BrF3N5O4+ and a molecular weight of 609.42 g/mol. Its IUPAC name is N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-4-ethylmorpholin-4-ium-4-carboxamide.
| Compound Name | N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-4-ethylmorpholin-4-ium-4-carboxamide |
|---|---|
| PubChem CID | 91209976 |
| Molecular Formula | C26H26BrF3N5O4+ |
| Molecular Weight | 609.42 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | N-[4-[4-[[4-bromo-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-4-ethylmorpholin-4-ium-4-carboxamide |
| SMILES | CC[N+]1(C(=O)Nc2cc(Oc3ccc(NC(=O)Nc4ccc(Br)c(C(F)(F)F)c4)cc3)ccn2)CCOCC1 |
| InChI | InChI=1S/C26H25BrF3N5O4/c1-2-35(11-13-38-14-12-35)25(37)34-23-16-20(9-10-31-23)39-19-6-3-17(4-7-19)32-24(36)33-18-5-8-22(27)21(15-18)26(28,29)30/h3-10,15-16H,2,11-14H2,1H3,(H2-,31,32,33,34,36,37)/p+1 |
| InChIKey | QQNJDSFCDKLPMX-UHFFFAOYSA-O |
| XLogP | 6.70 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.42 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|