C29H32ClF3N4O4 — CID 69009471
methyl 8-[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-methylamino]octanoate (PubChem CID 69009471) has the molecular formula C29H32ClF3N4O4 and a molecular weight of 593.05 g/mol. Its IUPAC name is methyl 8-[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-methylamino]octanoate.
| Compound Name | methyl 8-[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-methylamino]octanoate |
|---|---|
| PubChem CID | 69009471 |
| Molecular Formula | C29H32ClF3N4O4 |
| Molecular Weight | 593.05 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | methyl 8-[[4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-2-pyridinyl]-methylamino]octanoate |
| SMILES | COC(=O)CCCCCCCN(C)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C29H32ClF3N4O4/c1-37(17-7-5-3-4-6-8-27(38)40-2)26-19-23(15-16-34-26)41-22-12-9-20(10-13-22)35-28(39)36-21-11-14-25(30)24(18-21)29(31,32)33/h9-16,18-19H,3-8,17H2,1-2H3,(H2,35,36,39) |
| InChIKey | XPXQGEYYWHXJBJ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.05 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|