C23H22ClF3N4OS — CID 59700875
1-(4-chlorophenyl)-N-[(4-pentylphenyl)carbamothioyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 59700875) has the molecular formula C23H22ClF3N4OS and a molecular weight of 494.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[(4-pentylphenyl)carbamothioyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[(4-pentylphenyl)carbamothioyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 59700875 |
| Molecular Formula | C23H22ClF3N4OS |
| Molecular Weight | 494.97 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[(4-pentylphenyl)carbamothioyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCCCCc1ccc(NC(=S)NC(=O)c2cnn(-c3ccc(Cl)cc3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H22ClF3N4OS/c1-2-3-4-5-15-6-10-17(11-7-15)29-22(33)30-21(32)19-14-28-31(20(19)23(25,26)27)18-12-8-16(24)9-13-18/h6-14H,2-5H2,1H3,(H2,29,30,32,33) |
| InChIKey | MMYYQVDVAWHYRY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.97 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|