C23H30N3O3S+ — CID 7312503
4-butoxy-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]benzamide (PubChem CID 7312503) has the molecular formula C23H30N3O3S+ and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-butoxy-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-butoxy-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 7312503 |
| Molecular Formula | C23H30N3O3S+ |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 4-butoxy-N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)Nc2ccc(C[NH+]3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H29N3O3S/c1-2-3-14-29-21-10-6-19(7-11-21)22(27)25-23(30)24-20-8-4-18(5-9-20)17-26-12-15-28-16-13-26/h4-11H,2-3,12-17H2,1H3,(H2,24,25,27,30)/p+1 |
| InChIKey | INLXITJLTFOXLX-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 64.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|