C20H20FN3O3S — CID 59700775
N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-1,3-benzoxazole-2-carboxamide (PubChem CID 59700775) has the molecular formula C20H20FN3O3S and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 59700775 |
| Molecular Formula | C20H20FN3O3S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[(3-fluoro-4-pentoxyphenyl)carbamothioyl]-1,3-benzoxazole-2-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2nc3ccccc3o2)cc1F |
| InChI | InChI=1S/C20H20FN3O3S/c1-2-3-6-11-26-16-10-9-13(12-14(16)21)22-20(28)24-18(25)19-23-15-7-4-5-8-17(15)27-19/h4-5,7-10,12H,2-3,6,11H2,1H3,(H2,22,24,25,28) |
| InChIKey | BCHFONCYDZBXGI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|