C23H22F3N3O3S — CID 25174026
5-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]pyridine-3-carboxamide (PubChem CID 25174026) has the molecular formula C23H22F3N3O3S and a molecular weight of 477.51 g/mol. Its IUPAC name is 5-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]pyridine-3-carboxamide.
| Compound Name | 5-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 25174026 |
| Molecular Formula | C23H22F3N3O3S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 5-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]pyridine-3-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2cncc(-c3ccoc3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H22F3N3O3S/c1-2-3-4-8-32-20-6-5-18(11-19(20)23(24,25)26)28-22(33)29-21(30)17-10-16(12-27-13-17)15-7-9-31-14-15/h5-7,9-14H,2-4,8H2,1H3,(H2,28,29,30,33) |
| InChIKey | YZAFAHCKCRNIND-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|