C23H24F3N3O3S — CID 87447176
3-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2H-pyridine-3-carboxamide (PubChem CID 87447176) has the molecular formula C23H24F3N3O3S and a molecular weight of 479.52 g/mol. Its IUPAC name is 3-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2H-pyridine-3-carboxamide.
| Compound Name | 3-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87447176 |
| Molecular Formula | C23H24F3N3O3S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 3-(furan-3-yl)-N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2H-pyridine-3-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)C2(c3ccoc3)C=CC=NC2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H24F3N3O3S/c1-2-3-4-11-32-19-7-6-17(13-18(19)23(24,25)26)28-21(33)29-20(30)22(9-5-10-27-15-22)16-8-12-31-14-16/h5-10,12-14H,2-4,11,15H2,1H3,(H2,28,29,30,33) |
| InChIKey | MEIJBWGCVXWWRU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|