C20H20F3N4O3S+ — CID 162551128
N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide (PubChem CID 162551128) has the molecular formula C20H20F3N4O3S+ and a molecular weight of 453.47 g/mol. Its IUPAC name is N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide.
| Compound Name | N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide |
|---|---|
| PubChem CID | 162551128 |
| Molecular Formula | C20H20F3N4O3S+ |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[[4-pentoxy-3-(trifluoromethyl)phenyl]carbamothioyl]-2,1,3-benzoxadiazol-1-ium-5-carboxamide |
| SMILES | CCCCCOc1ccc(NC(=S)NC(=O)c2ccc3[nH+]onc3c2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H19F3N4O3S/c1-2-3-4-9-29-17-8-6-13(11-14(17)20(21,22)23)24-19(31)25-18(28)12-5-7-15-16(10-12)27-30-26-15/h5-8,10-11H,2-4,9H2,1H3,(H2,24,25,28,31)/p+1 |
| InChIKey | AUYCLQXFDZJJQW-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 90.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|