C18H16BrF3N2O2S — CID 17197836
3-bromo-4-propoxy-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide (PubChem CID 17197836) has the molecular formula C18H16BrF3N2O2S and a molecular weight of 461.30 g/mol. Its IUPAC name is 3-bromo-4-propoxy-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-propoxy-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17197836 |
| Molecular Formula | C18H16BrF3N2O2S |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 3-bromo-4-propoxy-N-[[3-(trifluoromethyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)Nc2cccc(C(F)(F)F)c2)cc1Br |
| InChI | InChI=1S/C18H16BrF3N2O2S/c1-2-8-26-15-7-6-11(9-14(15)19)16(25)24-17(27)23-13-5-3-4-12(10-13)18(20,21)22/h3-7,9-10H,2,8H2,1H3,(H2,23,24,25,27) |
| InChIKey | BBHOMRPSGFQYGN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|