C17H15F6N3S — CID 157454231
1-(4-aminophenyl)-3-[2-[2,4-bis(trifluoromethyl)phenyl]ethyl]thiourea (PubChem CID 157454231) has the molecular formula C17H15F6N3S and a molecular weight of 407.38 g/mol. Its IUPAC name is 1-(4-aminophenyl)-3-[2-[2,4-bis(trifluoromethyl)phenyl]ethyl]thiourea.
| Compound Name | 1-(4-aminophenyl)-3-[2-[2,4-bis(trifluoromethyl)phenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 157454231 |
| Molecular Formula | C17H15F6N3S |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 1-(4-aminophenyl)-3-[2-[2,4-bis(trifluoromethyl)phenyl]ethyl]thiourea |
| SMILES | Nc1ccc(NC(=S)NCCc2ccc(C(F)(F)F)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F6N3S/c18-16(19,20)11-2-1-10(14(9-11)17(21,22)23)7-8-25-15(27)26-13-5-3-12(24)4-6-13/h1-6,9H,7-8,24H2,(H2,25,26,27) |
| InChIKey | DRGVBTQRUQEWBW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|