C16H11ClF6N2OS — CID 3717572
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea (PubChem CID 3717572) has the molecular formula C16H11ClF6N2OS and a molecular weight of 428.79 g/mol. Its IUPAC name is 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea.
| Compound Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 3717572 |
| Molecular Formula | C16H11ClF6N2OS |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea |
| SMILES | FC(F)(F)Oc1cccc(CNC(=S)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H11ClF6N2OS/c17-13-5-4-10(7-12(13)15(18,19)20)25-14(27)24-8-9-2-1-3-11(6-9)26-16(21,22)23/h1-7H,8H2,(H2,24,25,27) |
| InChIKey | ARDREEMTEUJDRT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|