C14H10ClF3N2OS — CID 53365208
1-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea (PubChem CID 53365208) has the molecular formula C14H10ClF3N2OS and a molecular weight of 346.76 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 53365208 |
| Molecular Formula | C14H10ClF3N2OS |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
| SMILES | FC(F)(F)Oc1cccc(NC(=S)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C14H10ClF3N2OS/c15-9-4-6-10(7-5-9)19-13(22)20-11-2-1-3-12(8-11)21-14(16,17)18/h1-8H,(H2,19,20,22) |
| InChIKey | ZBNQVNDGZHDTRK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|