C16H15F3N2OS — CID 53488762
1-(2,5-dimethylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea (PubChem CID 53488762) has the molecular formula C16H15F3N2OS and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 53488762 |
| Molecular Formula | C16H15F3N2OS |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)Nc2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H15F3N2OS/c1-10-6-7-11(2)14(8-10)21-15(23)20-12-4-3-5-13(9-12)22-16(17,18)19/h3-9H,1-2H3,(H2,20,21,23) |
| InChIKey | YIBYIFNYHSPESP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|