C15H12F4N2OS — CID 53365215
1-(5-fluoro-2-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea (PubChem CID 53365215) has the molecular formula C15H12F4N2OS and a molecular weight of 344.33 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-(5-fluoro-2-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 53365215 |
| Molecular Formula | C15H12F4N2OS |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
| SMILES | Cc1ccc(F)cc1NC(=S)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F4N2OS/c1-9-5-6-10(16)7-13(9)21-14(23)20-11-3-2-4-12(8-11)22-15(17,18)19/h2-8H,1H3,(H2,20,21,23) |
| InChIKey | CXFSPZWXOPFRSJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|