C15H14F2N2S — CID 53489176
1-(3-fluoro-4-methylphenyl)-3-(5-fluoro-2-methylphenyl)thiourea (PubChem CID 53489176) has the molecular formula C15H14F2N2S and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-(3-fluoro-4-methylphenyl)-3-(5-fluoro-2-methylphenyl)thiourea.
| Compound Name | 1-(3-fluoro-4-methylphenyl)-3-(5-fluoro-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 53489176 |
| Molecular Formula | C15H14F2N2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-(3-fluoro-4-methylphenyl)-3-(5-fluoro-2-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2cc(F)ccc2C)cc1F |
| InChI | InChI=1S/C15H14F2N2S/c1-9-4-6-12(8-13(9)17)18-15(20)19-14-7-11(16)5-3-10(14)2/h3-8H,1-2H3,(H2,18,19,20) |
| InChIKey | HWQKUZWPKQKDFI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|