C21H18Cl2N4S2 — CID 6481333
1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamothioylamino]-4-methylphenyl]thiourea (PubChem CID 6481333) has the molecular formula C21H18Cl2N4S2 and a molecular weight of 461.44 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamothioylamino]-4-methylphenyl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamothioylamino]-4-methylphenyl]thiourea |
|---|---|
| PubChem CID | 6481333 |
| Molecular Formula | C21H18Cl2N4S2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[3-[(4-chlorophenyl)carbamothioylamino]-4-methylphenyl]thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc(Cl)cc2)cc1NC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18Cl2N4S2/c1-13-2-7-18(26-20(28)24-16-8-3-14(22)4-9-16)12-19(13)27-21(29)25-17-10-5-15(23)6-11-17/h2-12H,1H3,(H2,24,26,28)(H2,25,27,29) |
| InChIKey | PENVPDOXTHLNEB-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|