C16H14ClF3N2O2S — CID 53488824
1-(4-chloro-2-methoxy-5-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea (PubChem CID 53488824) has the molecular formula C16H14ClF3N2O2S and a molecular weight of 390.81 g/mol. Its IUPAC name is 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 53488824 |
| Molecular Formula | C16H14ClF3N2O2S |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | 1-(4-chloro-2-methoxy-5-methylphenyl)-3-[3-(trifluoromethoxy)phenyl]thiourea |
| SMILES | COc1cc(Cl)c(C)cc1NC(=S)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H14ClF3N2O2S/c1-9-6-13(14(23-2)8-12(9)17)22-15(25)21-10-4-3-5-11(7-10)24-16(18,19)20/h3-8H,1-2H3,(H2,21,22,25) |
| InChIKey | BQUIGJHEKSEELH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|