C17H16ClF3N2O3S — CID 3786652
1-(4-chloro-2,5-dimethoxyphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea (PubChem CID 3786652) has the molecular formula C17H16ClF3N2O3S and a molecular weight of 420.84 g/mol. Its IUPAC name is 1-(4-chloro-2,5-dimethoxyphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea.
| Compound Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 3786652 |
| Molecular Formula | C17H16ClF3N2O3S |
| Molecular Weight | 420.84 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 1-(4-chloro-2,5-dimethoxyphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]thiourea |
| SMILES | COc1cc(NC(=S)NCc2cccc(OC(F)(F)F)c2)c(OC)cc1Cl |
| InChI | InChI=1S/C17H16ClF3N2O3S/c1-24-14-8-13(15(25-2)7-12(14)18)23-16(27)22-9-10-4-3-5-11(6-10)26-17(19,20)21/h3-8H,9H2,1-2H3,(H2,22,23,27) |
| InChIKey | WQOQMANRVUVALE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|