C18H31ClN2O4S — CID 143811364
ethane;methyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate (PubChem CID 143811364) has the molecular formula C18H31ClN2O4S and a molecular weight of 406.98 g/mol. Its IUPAC name is ethane;methyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate.
| Compound Name | ethane;methyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 143811364 |
| Molecular Formula | C18H31ClN2O4S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | ethane;methyl 4-[(4-chloro-2,5-dimethoxyphenyl)carbamothioylamino]butanoate |
| SMILES | CC.CC.COC(=O)CCCNC(=S)Nc1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C14H19ClN2O4S.2C2H6/c1-19-11-8-10(12(20-2)7-9(11)15)17-14(22)16-6-4-5-13(18)21-3;2*1-2/h7-8H,4-6H2,1-3H3,(H2,16,17,22);2*1-2H3 |
| InChIKey | PANMOHRZBIGQOC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|