C14H18ClN3O5 — CID 108528884
N'-(4-chloro-2,5-dimethoxyphenyl)-N-(3-formamidopropyl)oxamide (PubChem CID 108528884) has the molecular formula C14H18ClN3O5 and a molecular weight of 343.77 g/mol. Its IUPAC name is N'-(4-chloro-2,5-dimethoxyphenyl)-N-(3-formamidopropyl)oxamide.
| Compound Name | N'-(4-chloro-2,5-dimethoxyphenyl)-N-(3-formamidopropyl)oxamide |
|---|---|
| PubChem CID | 108528884 |
| Molecular Formula | C14H18ClN3O5 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N'-(4-chloro-2,5-dimethoxyphenyl)-N-(3-formamidopropyl)oxamide |
| SMILES | COc1cc(NC(=O)C(=O)NCCCNC=O)c(OC)cc1Cl |
| InChI | InChI=1S/C14H18ClN3O5/c1-22-11-7-10(12(23-2)6-9(11)15)18-14(21)13(20)17-5-3-4-16-8-19/h6-8H,3-5H2,1-2H3,(H,16,19)(H,17,20)(H,18,21) |
| InChIKey | FKUGRHCJSHXEQD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|