C13H18ClNO4 — CID 43377856
methyl 4-(5-chloro-2,4-dimethoxyanilino)butanoate (PubChem CID 43377856) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is methyl 4-(5-chloro-2,4-dimethoxyanilino)butanoate.
| Compound Name | methyl 4-(5-chloro-2,4-dimethoxyanilino)butanoate |
|---|---|
| PubChem CID | 43377856 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 4-(5-chloro-2,4-dimethoxyanilino)butanoate |
| SMILES | COC(=O)CCCNc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C13H18ClNO4/c1-17-11-8-12(18-2)10(7-9(11)14)15-6-4-5-13(16)19-3/h7-8,15H,4-6H2,1-3H3 |
| InChIKey | JJYSBSMZYOVZJE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|