C13H18ClNO5 — CID 104643699
methyl 3-(5-chloro-2,4-dimethoxyanilino)-2-hydroxy-2-methylpropanoate (PubChem CID 104643699) has the molecular formula C13H18ClNO5 and a molecular weight of 303.74 g/mol. Its IUPAC name is methyl 3-(5-chloro-2,4-dimethoxyanilino)-2-hydroxy-2-methylpropanoate.
| Compound Name | methyl 3-(5-chloro-2,4-dimethoxyanilino)-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 104643699 |
| Molecular Formula | C13H18ClNO5 |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | methyl 3-(5-chloro-2,4-dimethoxyanilino)-2-hydroxy-2-methylpropanoate |
| SMILES | COC(=O)C(C)(O)CNc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C13H18ClNO5/c1-13(17,12(16)20-4)7-15-9-5-8(14)10(18-2)6-11(9)19-3/h5-6,15,17H,7H2,1-4H3 |
| InChIKey | LXQCNUFBEWVLHK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|