C16H25ClN2O4 — CID 103821609
tert-butyl N-[3-(5-chloro-2,4-dimethoxyanilino)propyl]carbamate (PubChem CID 103821609) has the molecular formula C16H25ClN2O4 and a molecular weight of 344.84 g/mol. Its IUPAC name is tert-butyl N-[3-(5-chloro-2,4-dimethoxyanilino)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(5-chloro-2,4-dimethoxyanilino)propyl]carbamate |
|---|---|
| PubChem CID | 103821609 |
| Molecular Formula | C16H25ClN2O4 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | tert-butyl N-[3-(5-chloro-2,4-dimethoxyanilino)propyl]carbamate |
| SMILES | COc1cc(OC)c(NCCCNC(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C16H25ClN2O4/c1-16(2,3)23-15(20)19-8-6-7-18-12-9-11(17)13(21-4)10-14(12)22-5/h9-10,18H,6-8H2,1-5H3,(H,19,20) |
| InChIKey | AGTXGNMKJFQLRY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|