C15H22ClNO5 — CID 142702396
tert-butyl N-[2-(3-chloro-4,5-dimethoxyphenoxy)ethyl]carbamate (PubChem CID 142702396) has the molecular formula C15H22ClNO5 and a molecular weight of 331.80 g/mol. Its IUPAC name is tert-butyl N-[2-(3-chloro-4,5-dimethoxyphenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-chloro-4,5-dimethoxyphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 142702396 |
| Molecular Formula | C15H22ClNO5 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | tert-butyl N-[2-(3-chloro-4,5-dimethoxyphenoxy)ethyl]carbamate |
| SMILES | COc1cc(OCCNC(=O)OC(C)(C)C)cc(Cl)c1OC |
| InChI | InChI=1S/C15H22ClNO5/c1-15(2,3)22-14(18)17-6-7-21-10-8-11(16)13(20-5)12(9-10)19-4/h8-9H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | JBCRTNYPTAXLCA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|