C15H20INO5 — CID 126622091
tert-butyl N-[2-(4-formyl-2-iodo-6-methoxyphenoxy)ethyl]carbamate (PubChem CID 126622091) has the molecular formula C15H20INO5 and a molecular weight of 421.23 g/mol. Its IUPAC name is tert-butyl N-[2-(4-formyl-2-iodo-6-methoxyphenoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-formyl-2-iodo-6-methoxyphenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 126622091 |
| Molecular Formula | C15H20INO5 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | tert-butyl N-[2-(4-formyl-2-iodo-6-methoxyphenoxy)ethyl]carbamate |
| SMILES | COc1cc(C=O)cc(I)c1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H20INO5/c1-15(2,3)22-14(19)17-5-6-21-13-11(16)7-10(9-18)8-12(13)20-4/h7-9H,5-6H2,1-4H3,(H,17,19) |
| InChIKey | QGISPSWDVPOVIY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|