C23H30N2O7 — CID 66613197
tert-butyl N-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethyl]carbamate (PubChem CID 66613197) has the molecular formula C23H30N2O7 and a molecular weight of 446.50 g/mol. Its IUPAC name is tert-butyl N-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 66613197 |
| Molecular Formula | C23H30N2O7 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | tert-butyl N-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethyl]carbamate |
| SMILES | COc1cc(/C=C/C(=O)N2CCC=CC2=O)cc(OC)c1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H30N2O7/c1-23(2,3)32-22(28)24-11-13-31-21-17(29-4)14-16(15-18(21)30-5)9-10-20(27)25-12-7-6-8-19(25)26/h6,8-10,14-15H,7,11-13H2,1-5H3,(H,24,28)/b10-9+ |
| InChIKey | NRIULLGZZMXEBQ-MDZDMXLPSA-N |
| XLogP | 2.94 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|