C24H33NO5 — CID 176713546
1-[(E)-3-[4-(3,3-dimethylhexoxy)-3,5-dimethoxyphenyl]prop-2-enoyl]-2,3-dihydropyridin-6-one (PubChem CID 176713546) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is 1-[(E)-3-[4-(3,3-dimethylhexoxy)-3,5-dimethoxyphenyl]prop-2-enoyl]-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(E)-3-[4-(3,3-dimethylhexoxy)-3,5-dimethoxyphenyl]prop-2-enoyl]-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 176713546 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[(E)-3-[4-(3,3-dimethylhexoxy)-3,5-dimethoxyphenyl]prop-2-enoyl]-2,3-dihydropyridin-6-one |
| SMILES | CCCC(C)(C)CCOc1c(OC)cc(/C=C/C(=O)N2CCC=CC2=O)cc1OC |
| InChI | InChI=1S/C24H33NO5/c1-6-12-24(2,3)13-15-30-23-19(28-4)16-18(17-20(23)29-5)10-11-22(27)25-14-8-7-9-21(25)26/h7,9-11,16-17H,6,8,12-15H2,1-5H3/b11-10+ |
| InChIKey | HQYXXDGOYIKWTO-ZHACJKMWSA-N |
| XLogP | 4.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|