C28H39NO10 — CID 168941336
tert-butyl 2-[2-[2-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 168941336) has the molecular formula C28H39NO10 and a molecular weight of 549.62 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 168941336 |
| Molecular Formula | C28H39NO10 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[2,6-dimethoxy-4-[(E)-3-oxo-3-(6-oxo-2,3-dihydropyridin-1-yl)prop-1-enyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | COc1cc(/C=C/C(=O)N2CCC=CC2=O)cc(OC)c1OCCOCCOCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H39NO10/c1-28(2,3)39-26(32)20-37-15-14-35-12-13-36-16-17-38-27-22(33-4)18-21(19-23(27)34-5)9-10-25(31)29-11-7-6-8-24(29)30/h6,8-10,18-19H,7,11-17,20H2,1-5H3/b10-9+ |
| InChIKey | JWEQHXCUYAPJKF-MDZDMXLPSA-N |
| XLogP | 2.80 |
| TPSA | 119.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|