C18H24O7 — CID 24530545
[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 24530545) has the molecular formula C18H24O7 and a molecular weight of 352.38 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 24530545 |
| Molecular Formula | C18H24O7 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)OC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C18H24O7/c1-18(2,3)25-16(20)11-24-15(19)8-7-12-9-13(21-4)17(23-6)14(10-12)22-5/h7-10H,11H2,1-6H3/b8-7+ |
| InChIKey | HIYJAGUZMVDPLA-BQYQJAHWSA-N |
| XLogP | 2.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|