C18H23NO8 — CID 9287863
[2-[(2-methoxy-2-oxoethyl)-methylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 9287863) has the molecular formula C18H23NO8 and a molecular weight of 381.38 g/mol. Its IUPAC name is [2-[(2-methoxy-2-oxoethyl)-methylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(2-methoxy-2-oxoethyl)-methylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9287863 |
| Molecular Formula | C18H23NO8 |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | [2-[(2-methoxy-2-oxoethyl)-methylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COC(=O)CN(C)C(=O)COC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H23NO8/c1-19(10-17(22)25-4)15(20)11-27-16(21)7-6-12-8-13(23-2)18(26-5)14(9-12)24-3/h6-9H,10-11H2,1-5H3/b7-6+ |
| InChIKey | LQXXPPSIKSDHEG-VOTSOKGWSA-N |
| XLogP | 0.90 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|