C28H34O12 — CID 89033467
(E)-3-[4-[2-[2-[2-[4-[(E)-2-carboxyethenyl]-2,6-dimethoxyphenoxy]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid (PubChem CID 89033467) has the molecular formula C28H34O12 and a molecular weight of 562.57 g/mol. Its IUPAC name is (E)-3-[4-[2-[2-[2-[4-[(E)-2-carboxyethenyl]-2,6-dimethoxyphenoxy]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-[2-[2-[4-[(E)-2-carboxyethenyl]-2,6-dimethoxyphenoxy]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89033467 |
| Molecular Formula | C28H34O12 |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (E)-3-[4-[2-[2-[2-[4-[(E)-2-carboxyethenyl]-2,6-dimethoxyphenoxy]ethoxy]ethoxy]ethoxy]-3-(hydroxymethyl)-5-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(CO)c1OCCOCCOCCOc1c(OC)cc(/C=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C28H34O12/c1-34-22-15-19(4-6-25(30)31)14-21(18-29)27(22)39-12-10-37-8-9-38-11-13-40-28-23(35-2)16-20(5-7-26(32)33)17-24(28)36-3/h4-7,14-17,29H,8-13,18H2,1-3H3,(H,30,31)(H,32,33)/b6-4+,7-5+ |
| InChIKey | KJFJUNIBOXZBMG-YDFGWWAZSA-N |
| XLogP | 2.89 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|