C14H15ClO5 — CID 43516853
(E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 43516853) has the molecular formula C14H15ClO5 and a molecular weight of 298.72 g/mol. Its IUPAC name is (E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43516853 |
| Molecular Formula | C14H15ClO5 |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (E)-3-[4-[(E)-3-chloroprop-2-enoxy]-3,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(OC)c1OC/C=C/Cl |
| InChI | InChI=1S/C14H15ClO5/c1-18-11-8-10(4-5-13(16)17)9-12(19-2)14(11)20-7-3-6-15/h3-6,8-9H,7H2,1-2H3,(H,16,17)/b5-4+,6-3+ |
| InChIKey | FCAQECOQBNYAKR-UTTVJGTNSA-N |
| XLogP | 2.93 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|