C25H30O9 — CID 67519396
1,5-bis[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one (PubChem CID 67519396) has the molecular formula C25H30O9 and a molecular weight of 474.51 g/mol. Its IUPAC name is 1,5-bis[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one.
| Compound Name | 1,5-bis[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 67519396 |
| Molecular Formula | C25H30O9 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1,5-bis[4-(2-hydroxyethoxy)-3,5-dimethoxyphenyl]penta-1,4-dien-3-one |
| SMILES | COc1cc(C=CC(=O)C=Cc2cc(OC)c(OCCO)c(OC)c2)cc(OC)c1OCCO |
| InChI | InChI=1S/C25H30O9/c1-29-20-13-17(14-21(30-2)24(20)33-11-9-26)5-7-19(28)8-6-18-15-22(31-3)25(34-12-10-27)23(16-18)32-4/h5-8,13-16,26-27H,9-12H2,1-4H3 |
| InChIKey | OFUFSVPMQSIAGX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|