C19H22ClNO6 — CID 7847992
[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 7847992) has the molecular formula C19H22ClNO6 and a molecular weight of 395.84 g/mol. Its IUPAC name is [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7847992 |
| Molecular Formula | C19H22ClNO6 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | [2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)OCC(=O)N2CCCC2=O)cc1OC |
| InChI | InChI=1S/C19H22ClNO6/c1-3-9-26-19-14(20)10-13(11-15(19)25-2)6-7-18(24)27-12-17(23)21-8-4-5-16(21)22/h6-7,10-11H,3-5,8-9,12H2,1-2H3/b7-6+ |
| InChIKey | NUXZPPVEYHTOJN-VOTSOKGWSA-N |
| XLogP | 2.84 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|