C17H19ClO6 — CID 7848030
[(3R)-2-oxooxolan-3-yl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 7848030) has the molecular formula C17H19ClO6 and a molecular weight of 354.79 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7848030 |
| Molecular Formula | C17H19ClO6 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)O[C@@H]2CCOC2=O)cc1OC |
| InChI | InChI=1S/C17H19ClO6/c1-3-7-22-16-12(18)9-11(10-14(16)21-2)4-5-15(19)24-13-6-8-23-17(13)20/h4-5,9-10,13H,3,6-8H2,1-2H3/b5-4+/t13-/m1/s1 |
| InChIKey | LADNETLILABOHU-MUBLQREKSA-N |
| XLogP | 3.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|