C20H28ClNO4 — CID 91943862
3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[(2-methyloxan-4-yl)methyl]prop-2-enamide (PubChem CID 91943862) has the molecular formula C20H28ClNO4 and a molecular weight of 381.90 g/mol. Its IUPAC name is 3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[(2-methyloxan-4-yl)methyl]prop-2-enamide.
| Compound Name | 3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[(2-methyloxan-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 91943862 |
| Molecular Formula | C20H28ClNO4 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-(3-chloro-5-methoxy-4-propoxyphenyl)-N-[(2-methyloxan-4-yl)methyl]prop-2-enamide |
| SMILES | CCCOc1c(Cl)cc(C=CC(=O)NCC2CCOC(C)C2)cc1OC |
| InChI | InChI=1S/C20H28ClNO4/c1-4-8-26-20-17(21)11-15(12-18(20)24-3)5-6-19(23)22-13-16-7-9-25-14(2)10-16/h5-6,11-12,14,16H,4,7-10,13H2,1-3H3,(H,22,23) |
| InChIKey | MVWKLGVFKWEFPX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|