C24H28ClN3O5 — CID 55526930
(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide (PubChem CID 55526930) has the molecular formula C24H28ClN3O5 and a molecular weight of 473.96 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55526930 |
| Molecular Formula | C24H28ClN3O5 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)Nc2ccc(NC(=O)NCC3CCCO3)cc2)cc1OC |
| InChI | InChI=1S/C24H28ClN3O5/c1-3-32-23-20(25)13-16(14-21(23)31-2)6-11-22(29)27-17-7-9-18(10-8-17)28-24(30)26-15-19-5-4-12-33-19/h6-11,13-14,19H,3-5,12,15H2,1-2H3,(H,27,29)(H2,26,28,30)/b11-6+ |
| InChIKey | DZQVPNQHABOCOZ-IZZDOVSWSA-N |
| XLogP | 4.70 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|