C22H24N2O4 — CID 17205611
4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17205611) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17205611 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[[(E)-3-(2-methoxyphenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COc1ccccc1/C=C/C(=O)Nc1ccc(C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-27-20-7-3-2-5-16(20)10-13-21(25)24-18-11-8-17(9-12-18)22(26)23-15-19-6-4-14-28-19/h2-3,5,7-13,19H,4,6,14-15H2,1H3,(H,23,26)(H,24,25)/b13-10+ |
| InChIKey | LBFMXKSAZJCVTA-JLHYYAGUSA-N |
| XLogP | 3.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|