C21H21ClN2O3 — CID 17205610
4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17205610) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is 4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17205610 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1ccc(C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C21H21ClN2O3/c22-19-6-2-1-4-15(19)9-12-20(25)24-17-10-7-16(8-11-17)21(26)23-14-18-5-3-13-27-18/h1-2,4,6-12,18H,3,5,13-14H2,(H,23,26)(H,24,25)/b12-9+ |
| InChIKey | VANILSFXJMRGBO-FMIVXFBMSA-N |
| XLogP | 3.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|