C23H25ClN2O4 — CID 24613482
(E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 24613482) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24613482 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)-N-[3-methyl-4-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)Nc2ccc(N3CCCC3=O)c(C)c2)cc1OC |
| InChI | InChI=1S/C23H25ClN2O4/c1-4-30-23-18(24)13-16(14-20(23)29-3)7-10-21(27)25-17-8-9-19(15(2)12-17)26-11-5-6-22(26)28/h7-10,12-14H,4-6,11H2,1-3H3,(H,25,27)/b10-7+ |
| InChIKey | IELBMIACXLJEQJ-JXMROGBWSA-N |
| XLogP | 4.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|