C20H19ClN2O3 — CID 55675011
(E)-3-(3-chlorophenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide (PubChem CID 55675011) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is (E)-3-(3-chlorophenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chlorophenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55675011 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (E)-3-(3-chlorophenyl)-N-[4-methoxy-3-(2-oxopyrrolidin-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2cccc(Cl)c2)cc1N1CCCC1=O |
| InChI | InChI=1S/C20H19ClN2O3/c1-26-18-9-8-16(13-17(18)23-11-3-6-20(23)25)22-19(24)10-7-14-4-2-5-15(21)12-14/h2,4-5,7-10,12-13H,3,6,11H2,1H3,(H,22,24)/b10-7+ |
| InChIKey | LDQNUIVGFKCBEI-JXMROGBWSA-N |
| XLogP | 4.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|