C17H19ClO5 — CID 4215502
(2-oxocyclohexyl) 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 4215502) has the molecular formula C17H19ClO5 and a molecular weight of 338.79 g/mol. Its IUPAC name is (2-oxocyclohexyl) 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (2-oxocyclohexyl) 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4215502 |
| Molecular Formula | C17H19ClO5 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2-oxocyclohexyl) 3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OC2CCCCC2=O)cc(Cl)c1OC |
| InChI | InChI=1S/C17H19ClO5/c1-21-15-10-11(9-12(18)17(15)22-2)7-8-16(20)23-14-6-4-3-5-13(14)19/h7-10,14H,3-6H2,1-2H3 |
| InChIKey | PCGXKEOVAAXCEA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|