C19H23ClO5 — CID 7804818
[(1R)-2-oxocyclohexyl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 7804818) has the molecular formula C19H23ClO5 and a molecular weight of 366.84 g/mol. Its IUPAC name is [(1R)-2-oxocyclohexyl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | [(1R)-2-oxocyclohexyl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7804818 |
| Molecular Formula | C19H23ClO5 |
| Molecular Weight | 366.84 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | [(1R)-2-oxocyclohexyl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2CCCCC2=O)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C19H23ClO5/c1-12(2)24-19-14(20)10-13(11-17(19)23-3)8-9-18(22)25-16-7-5-4-6-15(16)21/h8-12,16H,4-7H2,1-3H3/b9-8+/t16-/m1/s1 |
| InChIKey | LMSPQWHDKWAUDU-ROJDOSBLSA-N |
| XLogP | 4.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.84 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|