C20H26ClNO5 — CID 7804800
[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 7804800) has the molecular formula C20H26ClNO5 and a molecular weight of 395.88 g/mol. Its IUPAC name is [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7804800 |
| Molecular Formula | C20H26ClNO5 |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | [(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl] (E)-3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)C(=O)N2CCCC2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C20H26ClNO5/c1-13(2)26-19-16(21)11-15(12-17(19)25-4)7-8-18(23)27-14(3)20(24)22-9-5-6-10-22/h7-8,11-14H,5-6,9-10H2,1-4H3/b8-7+/t14-/m0/s1 |
| InChIKey | XLJVYQSGDUIYIB-NPQIQWPPSA-N |
| XLogP | 3.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|