C20H28ClNO3 — CID 75981658
3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one (PubChem CID 75981658) has the molecular formula C20H28ClNO3 and a molecular weight of 365.90 g/mol. Its IUPAC name is 3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one.
| Compound Name | 3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 75981658 |
| Molecular Formula | C20H28ClNO3 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-(3-chloro-5-methoxy-4-propan-2-yloxyphenyl)-1-(2-ethylpiperidin-1-yl)prop-2-en-1-one |
| SMILES | CCC1CCCCN1C(=O)C=Cc1cc(Cl)c(OC(C)C)c(OC)c1 |
| InChI | InChI=1S/C20H28ClNO3/c1-5-16-8-6-7-11-22(16)19(23)10-9-15-12-17(21)20(25-14(2)3)18(13-15)24-4/h9-10,12-14,16H,5-8,11H2,1-4H3 |
| InChIKey | FMSAKJTYWXMLQH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|