C21H28ClNO5 — CID 8972042
[(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 8972042) has the molecular formula C21H28ClNO5 and a molecular weight of 409.91 g/mol. Its IUPAC name is [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8972042 |
| Molecular Formula | C21H28ClNO5 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [(2R)-1-(azepan-1-yl)-1-oxopropan-2-yl] (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)O[C@H](C)C(=O)N2CCCCCC2)cc(Cl)c1OC |
| InChI | InChI=1S/C21H28ClNO5/c1-4-27-18-14-16(13-17(22)20(18)26-3)9-10-19(24)28-15(2)21(25)23-11-7-5-6-8-12-23/h9-10,13-15H,4-8,11-12H2,1-3H3/b10-9+/t15-/m1/s1 |
| InChIKey | YNDGTCOZENOTSZ-BOLDSZDNSA-N |
| XLogP | 4.09 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|