C20H26ClNO6 — CID 7684029
[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate (PubChem CID 7684029) has the molecular formula C20H26ClNO6 and a molecular weight of 411.88 g/mol. Its IUPAC name is [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7684029 |
| Molecular Formula | C20H26ClNO6 |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl] (E)-3-(3-chloro-4-ethoxy-5-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1c(Cl)cc(/C=C/C(=O)OCC(=O)N2C[C@@H](C)O[C@@H](C)C2)cc1OC |
| InChI | InChI=1S/C20H26ClNO6/c1-5-26-20-16(21)8-15(9-17(20)25-4)6-7-19(24)27-12-18(23)22-10-13(2)28-14(3)11-22/h6-9,13-14H,5,10-12H2,1-4H3/b7-6+/t13-,14+ |
| InChIKey | BNXJFXYIHVSDBU-RNBGUABESA-N |
| XLogP | 2.94 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|