C11H8F5IO3 — CID 176508000
3-iodo-5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)benzaldehyde (PubChem CID 176508000) has the molecular formula C11H8F5IO3 and a molecular weight of 410.08 g/mol. Its IUPAC name is 3-iodo-5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)benzaldehyde.
| Compound Name | 3-iodo-5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)benzaldehyde |
|---|---|
| PubChem CID | 176508000 |
| Molecular Formula | C11H8F5IO3 |
| Molecular Weight | 410.08 g/mol |
| Exact Mass | 409.94 |
| IUPAC Name | 3-iodo-5-methoxy-4-(2,2,3,3,3-pentafluoropropoxy)benzaldehyde |
| SMILES | COc1cc(C=O)cc(I)c1OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H8F5IO3/c1-19-8-3-6(4-18)2-7(17)9(8)20-5-10(12,13)11(14,15)16/h2-4H,5H2,1H3 |
| InChIKey | TVILUORXOJTGJK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.08 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|