C12H13F3O4S — CID 116616040
3,5-dimethoxy-4-[2-(trifluoromethylsulfanyl)ethoxy]benzaldehyde (PubChem CID 116616040) has the molecular formula C12H13F3O4S and a molecular weight of 310.29 g/mol. Its IUPAC name is 3,5-dimethoxy-4-[2-(trifluoromethylsulfanyl)ethoxy]benzaldehyde.
| Compound Name | 3,5-dimethoxy-4-[2-(trifluoromethylsulfanyl)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 116616040 |
| Molecular Formula | C12H13F3O4S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3,5-dimethoxy-4-[2-(trifluoromethylsulfanyl)ethoxy]benzaldehyde |
| SMILES | COc1cc(C=O)cc(OC)c1OCCSC(F)(F)F |
| InChI | InChI=1S/C12H13F3O4S/c1-17-9-5-8(7-16)6-10(18-2)11(9)19-3-4-20-12(13,14)15/h5-7H,3-4H2,1-2H3 |
| InChIKey | PUQBMZGGLYIHLL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|