C14H20ClNO4 — CID 79629813
methyl 3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropanoate (PubChem CID 79629813) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is methyl 3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79629813 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl 3-(5-chloro-2,4-dimethoxyanilino)-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CNc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C14H20ClNO4/c1-14(2,13(17)20-5)8-16-10-6-9(15)11(18-3)7-12(10)19-4/h6-7,16H,8H2,1-5H3 |
| InChIKey | VICOQTUMGLRAHL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|